C53H38N2OS — CID 145447509
N'-(2-phenylethyl)-N-[[8-[7-(3-phenylphenyl)cyclohepta-1,3,6-trien-1-yl]dibenzothiophen-1-yl]methylidene]dibenzofuran-3-carboximidamide (PubChem CID 145447509) has the molecular formula C53H38N2OS and a molecular weight of 750.97 g/mol. Its IUPAC name is N'-(2-phenylethyl)-N-[[8-[7-(3-phenylphenyl)cyclohepta-1,3,6-trien-1-yl]dibenzothiophen-1-yl]methylidene]dibenzofuran-3-carboximidamide.
| Compound Name | N'-(2-phenylethyl)-N-[[8-[7-(3-phenylphenyl)cyclohepta-1,3,6-trien-1-yl]dibenzothiophen-1-yl]methylidene]dibenzofuran-3-carboximidamide |
|---|---|
| PubChem CID | 145447509 |
| Molecular Formula | C53H38N2OS |
| Molecular Weight | 750.97 g/mol |
| Exact Mass | 750.27 |
| IUPAC Name | N'-(2-phenylethyl)-N-[[8-[7-(3-phenylphenyl)cyclohepta-1,3,6-trien-1-yl]dibenzothiophen-1-yl]methylidene]dibenzofuran-3-carboximidamide |
| SMILES | C1=CCC=C(c2cccc(-c3ccccc3)c2)C(c2ccc3sc4cccc(/C=N\C(=N\CCc5ccccc5)c5ccc6c(c5)oc5ccccc56)c4c3c2)=C1 |
| InChI | InChI=1S/C53H38N2OS/c1-4-14-36(15-5-1)30-31-54-53(41-26-28-46-45-23-10-11-24-48(45)56-49(46)34-41)55-35-42-20-13-25-51-52(42)47-33-40(27-29-50(47)57-51)44-22-9-3-8-21-43(44)39-19-12-18-38(32-39)37-16-6-2-7-17-37/h1-7,9-29,32-35H,8,30-31H2/b54-53+,55-35- |
| InChIKey | IEIKRLIRPLUMAN-IHGNXBHBSA-N |
| XLogP | 14.16 |
| TPSA | 37.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 750.97 |
| LogP ≤ 5 | 14.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|