C43H27N3OS — CID 176853606
N'-(benzenecarboximidoyl)-N-[(3-phenylnaphtho[1,2-b][1]benzofuran-6-yl)methylidene]dibenzothiophene-3-carboximidamide (PubChem CID 176853606) has the molecular formula C43H27N3OS and a molecular weight of 633.78 g/mol. Its IUPAC name is N'-(benzenecarboximidoyl)-N-[(3-phenylnaphtho[1,2-b][1]benzofuran-6-yl)methylidene]dibenzothiophene-3-carboximidamide.
| Compound Name | N'-(benzenecarboximidoyl)-N-[(3-phenylnaphtho[1,2-b][1]benzofuran-6-yl)methylidene]dibenzothiophene-3-carboximidamide |
|---|---|
| PubChem CID | 176853606 |
| Molecular Formula | C43H27N3OS |
| Molecular Weight | 633.78 g/mol |
| Exact Mass | 633.19 |
| IUPAC Name | N'-(benzenecarboximidoyl)-N-[(3-phenylnaphtho[1,2-b][1]benzofuran-6-yl)methylidene]dibenzothiophene-3-carboximidamide |
| SMILES | [H]/N=C(/N=C(/N=C/c1cc2cc(-c3ccccc3)ccc2c2oc3ccccc3c12)c1ccc2c(c1)sc1ccccc12)c1ccccc1 |
| InChI | InChI=1S/C43H27N3OS/c44-42(28-13-5-2-6-14-28)46-43(30-20-22-35-34-15-8-10-18-38(34)48-39(35)25-30)45-26-32-24-31-23-29(27-11-3-1-4-12-27)19-21-33(31)41-40(32)36-16-7-9-17-37(36)47-41/h1-26,44H/b44-42+,45-26+,46-43+ |
| InChIKey | RRQQZQNKYSZWDQ-RTDDKLKQSA-N |
| XLogP | 11.67 |
| TPSA | 61.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.78 |
| LogP ≤ 5 | 11.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|