C48H29N3O2S — CID 156643136
8-(3-dibenzothiophen-3-yldibenzofuran-1-yl)-N'-(naphthalene-2-carboximidoyl)dibenzofuran-1-carboximidamide (PubChem CID 156643136) has the molecular formula C48H29N3O2S and a molecular weight of 711.85 g/mol. Its IUPAC name is 8-(3-dibenzothiophen-3-yldibenzofuran-1-yl)-N'-(naphthalene-2-carboximidoyl)dibenzofuran-1-carboximidamide.
| Compound Name | 8-(3-dibenzothiophen-3-yldibenzofuran-1-yl)-N'-(naphthalene-2-carboximidoyl)dibenzofuran-1-carboximidamide |
|---|---|
| PubChem CID | 156643136 |
| Molecular Formula | C48H29N3O2S |
| Molecular Weight | 711.85 g/mol |
| Exact Mass | 711.20 |
| IUPAC Name | 8-(3-dibenzothiophen-3-yldibenzofuran-1-yl)-N'-(naphthalene-2-carboximidoyl)dibenzofuran-1-carboximidamide |
| SMILES | [H]/N=C(/N=C(/N)c1cccc2oc3ccc(-c4cc(-c5ccc6c(c5)sc5ccccc56)cc5oc6ccccc6c45)cc3c12)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C48H29N3O2S/c49-47(31-17-16-27-8-1-2-9-28(27)22-31)51-48(50)36-12-7-14-41-46(36)38-23-30(19-21-40(38)52-41)37-24-32(25-42-45(37)35-11-3-5-13-39(35)53-42)29-18-20-34-33-10-4-6-15-43(33)54-44(34)26-29/h1-26H,(H3,49,50,51) |
| InChIKey | ASTUYVPQRQAZOG-UHFFFAOYSA-N |
| XLogP | 13.07 |
| TPSA | 88.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.85 |
| LogP ≤ 5 | 13.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|