C44H31N3O — CID 145447845
N'-(benzenecarboximidoyl)-3-[8-[2-(2-phenylphenyl)phenyl]dibenzofuran-1-yl]benzenecarboximidamide (PubChem CID 145447845) has the molecular formula C44H31N3O and a molecular weight of 617.75 g/mol. Its IUPAC name is N'-(benzenecarboximidoyl)-3-[8-[2-(2-phenylphenyl)phenyl]dibenzofuran-1-yl]benzenecarboximidamide.
| Compound Name | N'-(benzenecarboximidoyl)-3-[8-[2-(2-phenylphenyl)phenyl]dibenzofuran-1-yl]benzenecarboximidamide |
|---|---|
| PubChem CID | 145447845 |
| Molecular Formula | C44H31N3O |
| Molecular Weight | 617.75 g/mol |
| Exact Mass | 617.25 |
| IUPAC Name | N'-(benzenecarboximidoyl)-3-[8-[2-(2-phenylphenyl)phenyl]dibenzofuran-1-yl]benzenecarboximidamide |
| SMILES | [H]/N=C(\N=C(/N)c1cccc(-c2cccc3oc4ccc(-c5ccccc5-c5ccccc5-c5ccccc5)cc4c23)c1)c1ccccc1 |
| InChI | InChI=1S/C44H31N3O/c45-43(30-15-5-2-6-16-30)47-44(46)33-18-11-17-31(27-33)36-23-12-24-41-42(36)39-28-32(25-26-40(39)48-41)35-20-8-10-22-38(35)37-21-9-7-19-34(37)29-13-3-1-4-14-29/h1-28H,(H3,45,46,47) |
| InChIKey | OWMGJGRQKVBOSC-UHFFFAOYSA-N |
| XLogP | 10.98 |
| TPSA | 75.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.75 |
| LogP ≤ 5 | 10.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|