C49H35N3O — CID 145447662
9,9-dimethyl-N'-[4-(8-phenanthren-9-yldibenzofuran-1-yl)benzenecarboximidoyl]fluorene-4-carboximidamide (PubChem CID 145447662) has the molecular formula C49H35N3O and a molecular weight of 681.84 g/mol. Its IUPAC name is 9,9-dimethyl-N'-[4-(8-phenanthren-9-yldibenzofuran-1-yl)benzenecarboximidoyl]fluorene-4-carboximidamide.
| Compound Name | 9,9-dimethyl-N'-[4-(8-phenanthren-9-yldibenzofuran-1-yl)benzenecarboximidoyl]fluorene-4-carboximidamide |
|---|---|
| PubChem CID | 145447662 |
| Molecular Formula | C49H35N3O |
| Molecular Weight | 681.84 g/mol |
| Exact Mass | 681.28 |
| IUPAC Name | 9,9-dimethyl-N'-[4-(8-phenanthren-9-yldibenzofuran-1-yl)benzenecarboximidoyl]fluorene-4-carboximidamide |
| SMILES | [H]/N=C(\N=C(/N)c1cccc2c1-c1ccccc1C2(C)C)c1ccc(-c2cccc3oc4ccc(-c5cc6ccccc6c6ccccc56)cc4c23)cc1 |
| InChI | InChI=1S/C49H35N3O/c1-49(2)41-18-8-7-15-37(41)45-38(17-9-19-42(45)49)48(51)52-47(50)30-23-21-29(22-24-30)34-16-10-20-44-46(34)40-28-32(25-26-43(40)53-44)39-27-31-11-3-4-12-33(31)35-13-5-6-14-36(35)39/h3-28H,1-2H3,(H3,50,51,52) |
| InChIKey | FOFWLSTYVFHLLB-UHFFFAOYSA-N |
| XLogP | 12.26 |
| TPSA | 75.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.84 |
| LogP ≤ 5 | 12.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|