C56H37N3O — CID 153369056
2-[8-[7-(9,9-dimethylfluoren-4-yl)phenanthren-2-yl]dibenzofuran-1-yl]-4,6-diphenyl-1,3,5-triazine (PubChem CID 153369056) has the molecular formula C56H37N3O and a molecular weight of 767.93 g/mol. Its IUPAC name is 2-[8-[7-(9,9-dimethylfluoren-4-yl)phenanthren-2-yl]dibenzofuran-1-yl]-4,6-diphenyl-1,3,5-triazine.
| Compound Name | 2-[8-[7-(9,9-dimethylfluoren-4-yl)phenanthren-2-yl]dibenzofuran-1-yl]-4,6-diphenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 153369056 |
| Molecular Formula | C56H37N3O |
| Molecular Weight | 767.93 g/mol |
| Exact Mass | 767.29 |
| IUPAC Name | 2-[8-[7-(9,9-dimethylfluoren-4-yl)phenanthren-2-yl]dibenzofuran-1-yl]-4,6-diphenyl-1,3,5-triazine |
| SMILES | CC1(C)c2ccccc2-c2c(-c3ccc4c(ccc5cc(-c6ccc7oc8cccc(-c9nc(-c%10ccccc%10)nc(-c%10ccccc%10)n9)c8c7c6)ccc54)c3)cccc21 |
| InChI | InChI=1S/C56H37N3O/c1-56(2)47-20-10-9-17-44(47)51-43(18-11-21-48(51)56)40-26-29-42-39(32-40)24-23-38-31-36(25-28-41(38)42)37-27-30-49-46(33-37)52-45(19-12-22-50(52)60-49)55-58-53(34-13-5-3-6-14-34)57-54(59-55)35-15-7-4-8-16-35/h3-33H,1-2H3 |
| InChIKey | QFUTWMCNRDPFAU-UHFFFAOYSA-N |
| XLogP | 14.72 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 767.93 |
| LogP ≤ 5 | 14.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|