C57H38N6O — CID 166565485
2-[5-[9-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzofuran-2-yl]-9,9-dimethylfluoren-2-yl]-4,6-diphenyl-1,3,5-triazine (PubChem CID 166565485) has the molecular formula C57H38N6O and a molecular weight of 822.97 g/mol. Its IUPAC name is 2-[5-[9-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzofuran-2-yl]-9,9-dimethylfluoren-2-yl]-4,6-diphenyl-1,3,5-triazine.
| Compound Name | 2-[5-[9-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzofuran-2-yl]-9,9-dimethylfluoren-2-yl]-4,6-diphenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 166565485 |
| Molecular Formula | C57H38N6O |
| Molecular Weight | 822.97 g/mol |
| Exact Mass | 822.31 |
| IUPAC Name | 2-[5-[9-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzofuran-2-yl]-9,9-dimethylfluoren-2-yl]-4,6-diphenyl-1,3,5-triazine |
| SMILES | CC1(C)c2cc(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)ccc2-c2c(-c3ccc4oc5cccc(-c6nc(-c7ccccc7)nc(-c7ccccc7)n6)c5c4c3)cccc21 |
| InChI | InChI=1S/C57H38N6O/c1-57(2)45-27-15-25-41(49(45)42-31-29-40(34-46(42)57)55-60-51(35-17-7-3-8-18-35)58-52(61-55)36-19-9-4-10-20-36)39-30-32-47-44(33-39)50-43(26-16-28-48(50)64-47)56-62-53(37-21-11-5-12-22-37)59-54(63-56)38-23-13-6-14-24-38/h3-34H,1-2H3 |
| InChIKey | MKLZGKBKYAFASY-UHFFFAOYSA-N |
| XLogP | 13.93 |
| TPSA | 90.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 822.97 |
| LogP ≤ 5 | 13.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |