C56H43N3O — CID 145447143
N-[amino(phenyl)methylidene]-9,9-dimethylfluorene-2-carboximidamide;1-(3-methylphenyl)-8-phenanthren-3-yldibenzofuran (PubChem CID 145447143) has the molecular formula C56H43N3O and a molecular weight of 773.98 g/mol. Its IUPAC name is N-[amino(phenyl)methylidene]-9,9-dimethylfluorene-2-carboximidamide;1-(3-methylphenyl)-8-phenanthren-3-yldibenzofuran.
| Compound Name | N-[amino(phenyl)methylidene]-9,9-dimethylfluorene-2-carboximidamide;1-(3-methylphenyl)-8-phenanthren-3-yldibenzofuran |
|---|---|
| PubChem CID | 145447143 |
| Molecular Formula | C56H43N3O |
| Molecular Weight | 773.98 g/mol |
| Exact Mass | 773.34 |
| IUPAC Name | N-[amino(phenyl)methylidene]-9,9-dimethylfluorene-2-carboximidamide;1-(3-methylphenyl)-8-phenanthren-3-yldibenzofuran |
| SMILES | Cc1cccc(-c2cccc3oc4ccc(-c5ccc6ccc7ccccc7c6c5)cc4c23)c1.[H]/N=C(\N=C(/N)c1ccccc1)c1ccc2c(c1)C(C)(C)c1ccccc1-2 |
| InChI | InChI=1S/C33H22O.C23H21N3/c1-21-6-4-8-26(18-21)28-10-5-11-32-33(28)30-20-25(16-17-31(30)34-32)24-15-14-23-13-12-22-7-2-3-9-27(22)29(23)19-24;1-23(2)19-11-7-6-10-17(19)18-13-12-16(14-20(18)23)22(25)26-21(24)15-8-4-3-5-9-15/h2-20H,1H3;3-14H,1-2H3,(H3,24,25,26) |
| InChIKey | FJDBYAWDJRDGSE-UHFFFAOYSA-N |
| XLogP | 14.26 |
| TPSA | 75.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 773.98 |
| LogP ≤ 5 | 14.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|