C46H35N3O — CID 142615355
N-[amino-(4-phenylphenyl)methylidene]dibenzofuran-2-carboximidamide;2-methyl-5-phenyl-9H-fluorene (PubChem CID 142615355) has the molecular formula C46H35N3O and a molecular weight of 645.81 g/mol. Its IUPAC name is N-[amino-(4-phenylphenyl)methylidene]dibenzofuran-2-carboximidamide;2-methyl-5-phenyl-9H-fluorene.
| Compound Name | N-[amino-(4-phenylphenyl)methylidene]dibenzofuran-2-carboximidamide;2-methyl-5-phenyl-9H-fluorene |
|---|---|
| PubChem CID | 142615355 |
| Molecular Formula | C46H35N3O |
| Molecular Weight | 645.81 g/mol |
| Exact Mass | 645.28 |
| IUPAC Name | N-[amino-(4-phenylphenyl)methylidene]dibenzofuran-2-carboximidamide;2-methyl-5-phenyl-9H-fluorene |
| SMILES | Cc1ccc2c(c1)Cc1cccc(-c3ccccc3)c1-2.[H]/N=C(\N=C(/N)c1ccc(-c2ccccc2)cc1)c1ccc2oc3ccccc3c2c1 |
| InChI | InChI=1S/C26H19N3O.C20H16/c27-25(19-12-10-18(11-13-19)17-6-2-1-3-7-17)29-26(28)20-14-15-24-22(16-20)21-8-4-5-9-23(21)30-24;1-14-10-11-19-17(12-14)13-16-8-5-9-18(20(16)19)15-6-3-2-4-7-15/h1-16H,(H3,27,28,29);2-12H,13H2,1H3 |
| InChIKey | IAZJEDBLJALKTD-UHFFFAOYSA-N |
| XLogP | 11.22 |
| TPSA | 75.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.81 |
| LogP ≤ 5 | 11.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|