C44H29N3O — CID 137302881
N-[amino(phenyl)methylidene]-10-(4-naphtho[1,2-b][1]benzofuran-5-ylphenyl)phenanthrene-9-carboximidamide (PubChem CID 137302881) has the molecular formula C44H29N3O and a molecular weight of 615.74 g/mol. Its IUPAC name is N-[amino(phenyl)methylidene]-10-(4-naphtho[1,2-b][1]benzofuran-5-ylphenyl)phenanthrene-9-carboximidamide.
| Compound Name | N-[amino(phenyl)methylidene]-10-(4-naphtho[1,2-b][1]benzofuran-5-ylphenyl)phenanthrene-9-carboximidamide |
|---|---|
| PubChem CID | 137302881 |
| Molecular Formula | C44H29N3O |
| Molecular Weight | 615.74 g/mol |
| Exact Mass | 615.23 |
| IUPAC Name | N-[amino(phenyl)methylidene]-10-(4-naphtho[1,2-b][1]benzofuran-5-ylphenyl)phenanthrene-9-carboximidamide |
| SMILES | [H]/N=C(\N=C(/N)c1ccccc1)c1c(-c2ccc(-c3cc4c5ccccc5oc4c4ccccc34)cc2)c2ccccc2c2ccccc12 |
| InChI | InChI=1S/C44H29N3O/c45-43(29-12-2-1-3-13-29)47-44(46)41-35-19-8-5-15-31(35)30-14-4-7-18-34(30)40(41)28-24-22-27(23-25-28)37-26-38-33-17-10-11-21-39(33)48-42(38)36-20-9-6-16-32(36)37/h1-26H,(H3,45,46,47) |
| InChIKey | IPOJOYQIDIPFGJ-UHFFFAOYSA-N |
| XLogP | 11.11 |
| TPSA | 75.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.74 |
| LogP ≤ 5 | 11.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|