C52H39N3O — CID 135245364
N-[(2E,4Z)-1-amino-2-ethenylhexa-2,4-dienylidene]-N'-[[10-(4-naphtho[1,2-b][1]benzofuran-5-ylphenyl)phenanthren-9-yl]methyl]benzenecarboximidamide (PubChem CID 135245364) has the molecular formula C52H39N3O and a molecular weight of 721.90 g/mol. Its IUPAC name is N-[(2E,4Z)-1-amino-2-ethenylhexa-2,4-dienylidene]-N'-[[10-(4-naphtho[1,2-b][1]benzofuran-5-ylphenyl)phenanthren-9-yl]methyl]benzenecarboximidamide.
| Compound Name | N-[(2E,4Z)-1-amino-2-ethenylhexa-2,4-dienylidene]-N'-[[10-(4-naphtho[1,2-b][1]benzofuran-5-ylphenyl)phenanthren-9-yl]methyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 135245364 |
| Molecular Formula | C52H39N3O |
| Molecular Weight | 721.90 g/mol |
| Exact Mass | 721.31 |
| IUPAC Name | N-[(2E,4Z)-1-amino-2-ethenylhexa-2,4-dienylidene]-N'-[[10-(4-naphtho[1,2-b][1]benzofuran-5-ylphenyl)phenanthren-9-yl]methyl]benzenecarboximidamide |
| SMILES | C=CC(=C\C=C/C)/C(N)=N/C(=N\Cc1c(-c2ccc(-c3cc4c5ccccc5oc4c4ccccc34)cc2)c2ccccc2c2ccccc12)c1ccccc1 |
| InChI | InChI=1S/C52H39N3O/c1-3-5-17-34(4-2)51(53)55-52(37-18-7-6-8-19-37)54-33-47-40-22-10-9-20-38(40)39-21-11-13-25-43(39)49(47)36-30-28-35(29-31-36)45-32-46-42-24-15-16-27-48(42)56-50(46)44-26-14-12-23-41(44)45/h3-32H,2,33H2,1H3,(H2,53,54,55)/b5-3-,34-17+ |
| InChIKey | LTSQUANHPPOGPT-OYTGTYONSA-N |
| XLogP | 13.37 |
| TPSA | 63.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 721.90 |
| LogP ≤ 5 | 13.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|