C32H23N3O — CID 174023175
N-[amino-(3-phenylphenyl)methylidene]-3-phenyldibenzofuran-1-carboximidamide (PubChem CID 174023175) has the molecular formula C32H23N3O and a molecular weight of 465.56 g/mol. Its IUPAC name is N-[amino-(3-phenylphenyl)methylidene]-3-phenyldibenzofuran-1-carboximidamide.
| Compound Name | N-[amino-(3-phenylphenyl)methylidene]-3-phenyldibenzofuran-1-carboximidamide |
|---|---|
| PubChem CID | 174023175 |
| Molecular Formula | C32H23N3O |
| Molecular Weight | 465.56 g/mol |
| Exact Mass | 465.18 |
| IUPAC Name | N-[amino-(3-phenylphenyl)methylidene]-3-phenyldibenzofuran-1-carboximidamide |
| SMILES | [H]/N=C(\N=C(/N)c1cccc(-c2ccccc2)c1)c1cc(-c2ccccc2)cc2oc3ccccc3c12 |
| InChI | InChI=1S/C32H23N3O/c33-31(24-15-9-14-23(18-24)21-10-3-1-4-11-21)35-32(34)27-19-25(22-12-5-2-6-13-22)20-29-30(27)26-16-7-8-17-28(26)36-29/h1-20H,(H3,33,34,35) |
| InChIKey | UMYKNVCQGMFKBN-UHFFFAOYSA-N |
| XLogP | 7.65 |
| TPSA | 75.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.56 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|