C51H37N5O — CID 170785636
N'-(benzenecarboximidoyl)benzenecarboximidamide;5-(9-methyldibenzofuran-2-yl)-7-phenylindolo[2,3-b]carbazole (PubChem CID 170785636) has the molecular formula C51H37N5O and a molecular weight of 735.89 g/mol. Its IUPAC name is N'-(benzenecarboximidoyl)benzenecarboximidamide;5-(9-methyldibenzofuran-2-yl)-7-phenylindolo[2,3-b]carbazole.
| Compound Name | N'-(benzenecarboximidoyl)benzenecarboximidamide;5-(9-methyldibenzofuran-2-yl)-7-phenylindolo[2,3-b]carbazole |
|---|---|
| PubChem CID | 170785636 |
| Molecular Formula | C51H37N5O |
| Molecular Weight | 735.89 g/mol |
| Exact Mass | 735.30 |
| IUPAC Name | N'-(benzenecarboximidoyl)benzenecarboximidamide;5-(9-methyldibenzofuran-2-yl)-7-phenylindolo[2,3-b]carbazole |
| SMILES | Cc1cccc2oc3ccc(-n4c5ccccc5c5cc6c7ccccc7n(-c7ccccc7)c6cc54)cc3c12.[H]/N=C(/N=C(\N)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C37H24N2O.C14H13N3/c1-23-10-9-17-36-37(23)30-20-25(18-19-35(30)40-36)39-32-16-8-6-14-27(32)29-21-28-26-13-5-7-15-31(26)38(33(28)22-34(29)39)24-11-3-2-4-12-24;15-13(11-7-3-1-4-8-11)17-14(16)12-9-5-2-6-10-12/h2-22H,1H3;1-10H,(H3,15,16,17) |
| InChIKey | PFLSLEFWPCELEE-UHFFFAOYSA-N |
| XLogP | 12.51 |
| TPSA | 85.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.89 |
| LogP ≤ 5 | 12.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|