C38H26N4O — CID 144914923
N-[amino(phenyl)methylidene]-3-(14-oxa-17-azahexacyclo[13.11.0.02,7.08,13.016,24.018,23]hexacosa-1(15),2,4,6,8,10,12,16(24),18,20,22,25-dodecaen-17-yl)benzenecarboximidamide (PubChem CID 144914923) has the molecular formula C38H26N4O and a molecular weight of 554.65 g/mol. Its IUPAC name is N-[amino(phenyl)methylidene]-3-(14-oxa-17-azahexacyclo[13.11.0.02,7.08,13.016,24.018,23]hexacosa-1(15),2,4,6,8,10,12,16(24),18,20,22,25-dodecaen-17-yl)benzenecarboximidamide.
| Compound Name | N-[amino(phenyl)methylidene]-3-(14-oxa-17-azahexacyclo[13.11.0.02,7.08,13.016,24.018,23]hexacosa-1(15),2,4,6,8,10,12,16(24),18,20,22,25-dodecaen-17-yl)benzenecarboximidamide |
|---|---|
| PubChem CID | 144914923 |
| Molecular Formula | C38H26N4O |
| Molecular Weight | 554.65 g/mol |
| Exact Mass | 554.21 |
| IUPAC Name | N-[amino(phenyl)methylidene]-3-(14-oxa-17-azahexacyclo[13.11.0.02,7.08,13.016,24.018,23]hexacosa-1(15),2,4,6,8,10,12,16(24),18,20,22,25-dodecaen-17-yl)benzenecarboximidamide |
| SMILES | [H]/N=C(\N=C(/N)c1ccccc1)c1cccc(-n2c3ccccc3c3ccc4c(c32)Oc2ccccc2-c2ccccc2-4)c1 |
| InChI | InChI=1S/C38H26N4O/c39-37(24-11-2-1-3-12-24)41-38(40)25-13-10-14-26(23-25)42-33-19-8-6-17-29(33)31-21-22-32-28-16-5-4-15-27(28)30-18-7-9-20-34(30)43-36(32)35(31)42/h1-23H,(H3,39,40,41) |
| InChIKey | WZJTXUUEIIKODG-UHFFFAOYSA-N |
| XLogP | 8.95 |
| TPSA | 76.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.65 |
| LogP ≤ 5 | 8.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|