C47H35N5 — CID 144645258
N-[amino(phenyl)methylidene]-9,9-dimethyl-7-(7-phenyl-7,20-diazapentacyclo[11.7.0.02,10.04,8.014,19]icosa-1(13),2(10),3,5,8,11,14,16,18-nonaen-20-yl)fluorene-2-carboximidamide (PubChem CID 144645258) has the molecular formula C47H35N5 and a molecular weight of 669.83 g/mol. Its IUPAC name is N-[amino(phenyl)methylidene]-9,9-dimethyl-7-(7-phenyl-7,20-diazapentacyclo[11.7.0.02,10.04,8.014,19]icosa-1(13),2(10),3,5,8,11,14,16,18-nonaen-20-yl)fluorene-2-carboximidamide.
| Compound Name | N-[amino(phenyl)methylidene]-9,9-dimethyl-7-(7-phenyl-7,20-diazapentacyclo[11.7.0.02,10.04,8.014,19]icosa-1(13),2(10),3,5,8,11,14,16,18-nonaen-20-yl)fluorene-2-carboximidamide |
|---|---|
| PubChem CID | 144645258 |
| Molecular Formula | C47H35N5 |
| Molecular Weight | 669.83 g/mol |
| Exact Mass | 669.29 |
| IUPAC Name | N-[amino(phenyl)methylidene]-9,9-dimethyl-7-(7-phenyl-7,20-diazapentacyclo[11.7.0.02,10.04,8.014,19]icosa-1(13),2(10),3,5,8,11,14,16,18-nonaen-20-yl)fluorene-2-carboximidamide |
| SMILES | [H]/N=C(\N=C(/N)c1ccccc1)c1ccc2c(c1)C(C)(C)c1cc(-n3c4ccccc4c4ccc5cc6c(ccn6-c6ccccc6)cc5c43)ccc1-2 |
| InChI | InChI=1S/C47H35N5/c1-47(2)40-26-32(46(49)50-45(48)29-11-5-3-6-12-29)18-20-35(40)36-22-19-34(28-41(36)47)52-42-16-10-9-15-37(42)38-21-17-30-27-43-31(25-39(30)44(38)52)23-24-51(43)33-13-7-4-8-14-33/h3-28H,1-2H3,(H3,48,49,50) |
| InChIKey | NZDVBROJYBIVRZ-UHFFFAOYSA-N |
| XLogP | 10.92 |
| TPSA | 72.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.83 |
| LogP ≤ 5 | 10.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|