C53H38N4 — CID 145303561
N-[amino(phenyl)methylidene]-10-[4-(1-azapentacyclo[10.6.1.02,7.08,19.013,18]nonadeca-2(7),3,5,8,10,12(19),13,15,17-nonaen-4-yl)phenyl]phenanthrene-9-carboximidamide;toluene (PubChem CID 145303561) has the molecular formula C53H38N4 and a molecular weight of 730.92 g/mol. Its IUPAC name is N-[amino(phenyl)methylidene]-10-[4-(1-azapentacyclo[10.6.1.02,7.08,19.013,18]nonadeca-2(7),3,5,8,10,12(19),13,15,17-nonaen-4-yl)phenyl]phenanthrene-9-carboximidamide;toluene.
| Compound Name | N-[amino(phenyl)methylidene]-10-[4-(1-azapentacyclo[10.6.1.02,7.08,19.013,18]nonadeca-2(7),3,5,8,10,12(19),13,15,17-nonaen-4-yl)phenyl]phenanthrene-9-carboximidamide;toluene |
|---|---|
| PubChem CID | 145303561 |
| Molecular Formula | C53H38N4 |
| Molecular Weight | 730.92 g/mol |
| Exact Mass | 730.31 |
| IUPAC Name | N-[amino(phenyl)methylidene]-10-[4-(1-azapentacyclo[10.6.1.02,7.08,19.013,18]nonadeca-2(7),3,5,8,10,12(19),13,15,17-nonaen-4-yl)phenyl]phenanthrene-9-carboximidamide;toluene |
| SMILES | Cc1ccccc1.[H]/N=C(\N=C(/N)c1ccccc1)c1c(-c2ccc(-c3ccc4c5cccc6c7ccccc7n(c4c3)c65)cc2)c2ccccc2c2ccccc12 |
| InChI | InChI=1S/C46H30N4.C7H8/c47-45(30-11-2-1-3-12-30)49-46(48)43-37-17-7-5-14-33(37)32-13-4-6-16-36(32)42(43)29-23-21-28(22-24-29)31-25-26-35-39-19-10-18-38-34-15-8-9-20-40(34)50(44(38)39)41(35)27-31;1-7-5-3-2-4-6-7/h1-27H,(H3,47,48,49);2-6H,1H3 |
| InChIKey | ZOPIWSYXOXVPRQ-UHFFFAOYSA-N |
| XLogP | 13.20 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.92 |
| LogP ≤ 5 | 13.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|