C21H20BrN3 — CID 142324241
N'-(benzenecarboximidoyl)benzenecarboximidamide;1-bromo-3-methylbenzene (PubChem CID 142324241) has the molecular formula C21H20BrN3 and a molecular weight of 394.32 g/mol. Its IUPAC name is N'-(benzenecarboximidoyl)benzenecarboximidamide;1-bromo-3-methylbenzene.
| Compound Name | N'-(benzenecarboximidoyl)benzenecarboximidamide;1-bromo-3-methylbenzene |
|---|---|
| PubChem CID | 142324241 |
| Molecular Formula | C21H20BrN3 |
| Molecular Weight | 394.32 g/mol |
| Exact Mass | 393.08 |
| IUPAC Name | N'-(benzenecarboximidoyl)benzenecarboximidamide;1-bromo-3-methylbenzene |
| SMILES | Cc1cccc(Br)c1.[H]/N=C(/N=C(\N)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C14H13N3.C7H7Br/c15-13(11-7-3-1-4-8-11)17-14(16)12-9-5-2-6-10-12;1-6-3-2-4-7(8)5-6/h1-10H,(H3,15,16,17);2-5H,1H3 |
| InChIKey | LBIBFCFCOZJTRY-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 62.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.32 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|