C27H25N3S — CID 145452295
N'-(benzenecarboximidoyl)benzenecarboximidamide;7-methyl-2,3-dihydrodibenzothiophene (PubChem CID 145452295) has the molecular formula C27H25N3S and a molecular weight of 423.59 g/mol. Its IUPAC name is N'-(benzenecarboximidoyl)benzenecarboximidamide;7-methyl-2,3-dihydrodibenzothiophene.
| Compound Name | N'-(benzenecarboximidoyl)benzenecarboximidamide;7-methyl-2,3-dihydrodibenzothiophene |
|---|---|
| PubChem CID | 145452295 |
| Molecular Formula | C27H25N3S |
| Molecular Weight | 423.59 g/mol |
| Exact Mass | 423.18 |
| IUPAC Name | N'-(benzenecarboximidoyl)benzenecarboximidamide;7-methyl-2,3-dihydrodibenzothiophene |
| SMILES | Cc1ccc2c3c(sc2c1)=CCCC=3.[H]/N=C(/N=C(\N)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C14H13N3.C13H12S/c15-13(11-7-3-1-4-8-11)17-14(16)12-9-5-2-6-10-12;1-9-6-7-11-10-4-2-3-5-12(10)14-13(11)8-9/h1-10H,(H3,15,16,17);4-8H,2-3H2,1H3 |
| InChIKey | LFWYDISMYAWKRS-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 62.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.59 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|