C52H41N3S — CID 145447639
N'-(benzenecarboximidoyl)-4-[9-[(E,1E)-1-(10-methylidenephenanthren-9-ylidene)but-2-en-2-yl]dibenzothiophen-1-yl]benzenecarboximidamide;toluene (PubChem CID 145447639) has the molecular formula C52H41N3S and a molecular weight of 739.99 g/mol. Its IUPAC name is N'-(benzenecarboximidoyl)-4-[9-[(E,1E)-1-(10-methylidenephenanthren-9-ylidene)but-2-en-2-yl]dibenzothiophen-1-yl]benzenecarboximidamide;toluene.
| Compound Name | N'-(benzenecarboximidoyl)-4-[9-[(E,1E)-1-(10-methylidenephenanthren-9-ylidene)but-2-en-2-yl]dibenzothiophen-1-yl]benzenecarboximidamide;toluene |
|---|---|
| PubChem CID | 145447639 |
| Molecular Formula | C52H41N3S |
| Molecular Weight | 739.99 g/mol |
| Exact Mass | 739.30 |
| IUPAC Name | N'-(benzenecarboximidoyl)-4-[9-[(E,1E)-1-(10-methylidenephenanthren-9-ylidene)but-2-en-2-yl]dibenzothiophen-1-yl]benzenecarboximidamide;toluene |
| SMILES | Cc1ccccc1.[H]/N=C(/N=C(/N)c1ccc(-c2cccc3sc4cccc(C(=C/C)/C=c5/c(=C)c6ccccc6c6ccccc56)c4c23)cc1)c1ccccc1 |
| InChI | InChI=1S/C45H33N3S.C7H8/c1-3-29(27-39-28(2)33-15-7-8-16-36(33)37-17-9-10-18-38(37)39)34-19-11-21-40-42(34)43-35(20-12-22-41(43)49-40)30-23-25-32(26-24-30)45(47)48-44(46)31-13-5-4-6-14-31;1-7-5-3-2-4-6-7/h3-27H,2H2,1H3,(H3,46,47,48);2-6H,1H3/b29-3+,39-27+; |
| InChIKey | MHTMJERZHCBVPM-OJOCDRNISA-N |
| XLogP | 12.05 |
| TPSA | 62.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 739.99 |
| LogP ≤ 5 | 12.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|