C50H39N5S3 — CID 142519244
2-(benzenecarboximidoyl)-1-benzothiophen-3-amine;N'-(dibenzothiophene-2-carboximidoyl)-9-methyl-N-methylidenedibenzothiophene-1-carboximidamide;toluene (PubChem CID 142519244) has the molecular formula C50H39N5S3 and a molecular weight of 806.10 g/mol. Its IUPAC name is 2-(benzenecarboximidoyl)-1-benzothiophen-3-amine;N'-(dibenzothiophene-2-carboximidoyl)-9-methyl-N-methylidenedibenzothiophene-1-carboximidamide;toluene.
| Compound Name | 2-(benzenecarboximidoyl)-1-benzothiophen-3-amine;N'-(dibenzothiophene-2-carboximidoyl)-9-methyl-N-methylidenedibenzothiophene-1-carboximidamide;toluene |
|---|---|
| PubChem CID | 142519244 |
| Molecular Formula | C50H39N5S3 |
| Molecular Weight | 806.10 g/mol |
| Exact Mass | 805.24 |
| IUPAC Name | 2-(benzenecarboximidoyl)-1-benzothiophen-3-amine;N'-(dibenzothiophene-2-carboximidoyl)-9-methyl-N-methylidenedibenzothiophene-1-carboximidamide;toluene |
| SMILES | Cc1ccccc1.[H]/N=C(/N=C(/N=C)c1cccc2sc3cccc(C)c3c12)c1ccc2sc3ccccc3c2c1.[H]/N=C(\c1ccccc1)c1sc2ccccc2c1N |
| InChI | InChI=1S/C28H19N3S2.C15H12N2S.C7H8/c1-16-7-5-11-23-25(16)26-19(9-6-12-24(26)33-23)28(30-2)31-27(29)17-13-14-22-20(15-17)18-8-3-4-10-21(18)32-22;16-13(10-6-2-1-3-7-10)15-14(17)11-8-4-5-9-12(11)18-15;1-7-5-3-2-4-6-7/h3-15,29H,2H2,1H3;1-9,16H,17H2;2-6H,1H3/b29-27+,31-28+;16-13+; |
| InChIKey | ZFPLBDAURSTDLB-BJZIBATGSA-N |
| XLogP | 14.10 |
| TPSA | 98.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 806.10 |
| LogP ≤ 5 | 14.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|