C49H35N5OS — CID 142519454
2-(benzenecarboximidoyl)-1-benzofuran-3-amine;2-(8-methyldibenzothiophen-1-yl)-4-phenyl-6-(3-phenylphenyl)-1,3,5-triazine (PubChem CID 142519454) has the molecular formula C49H35N5OS and a molecular weight of 741.92 g/mol. Its IUPAC name is 2-(benzenecarboximidoyl)-1-benzofuran-3-amine;2-(8-methyldibenzothiophen-1-yl)-4-phenyl-6-(3-phenylphenyl)-1,3,5-triazine.
| Compound Name | 2-(benzenecarboximidoyl)-1-benzofuran-3-amine;2-(8-methyldibenzothiophen-1-yl)-4-phenyl-6-(3-phenylphenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 142519454 |
| Molecular Formula | C49H35N5OS |
| Molecular Weight | 741.92 g/mol |
| Exact Mass | 741.26 |
| IUPAC Name | 2-(benzenecarboximidoyl)-1-benzofuran-3-amine;2-(8-methyldibenzothiophen-1-yl)-4-phenyl-6-(3-phenylphenyl)-1,3,5-triazine |
| SMILES | Cc1ccc2sc3cccc(-c4nc(-c5ccccc5)nc(-c5cccc(-c6ccccc6)c5)n4)c3c2c1.[H]/N=C(\c1ccccc1)c1oc2ccccc2c1N |
| InChI | InChI=1S/C34H23N3S.C15H12N2O/c1-22-18-19-29-28(20-22)31-27(16-9-17-30(31)38-29)34-36-32(24-12-6-3-7-13-24)35-33(37-34)26-15-8-14-25(21-26)23-10-4-2-5-11-23;16-13(10-6-2-1-3-7-10)15-14(17)11-8-4-5-9-12(11)18-15/h2-21H,1H3;1-9,16H,17H2/b;16-13+ |
| InChIKey | QSJYGZTYAIWDGN-MDPUXWEUSA-N |
| XLogP | 12.65 |
| TPSA | 101.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 741.92 |
| LogP ≤ 5 | 12.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|