C55H45N5OS — CID 142519266
2-(9,9-dimethylfluorene-2-carboximidoyl)-1-benzofuran-3-amine;2-(8-methyldibenzothiophen-1-yl)-4,6-diphenyl-1,3,5-triazine;prop-1-ene (PubChem CID 142519266) has the molecular formula C55H45N5OS and a molecular weight of 824.07 g/mol. Its IUPAC name is 2-(9,9-dimethylfluorene-2-carboximidoyl)-1-benzofuran-3-amine;2-(8-methyldibenzothiophen-1-yl)-4,6-diphenyl-1,3,5-triazine;prop-1-ene.
| Compound Name | 2-(9,9-dimethylfluorene-2-carboximidoyl)-1-benzofuran-3-amine;2-(8-methyldibenzothiophen-1-yl)-4,6-diphenyl-1,3,5-triazine;prop-1-ene |
|---|---|
| PubChem CID | 142519266 |
| Molecular Formula | C55H45N5OS |
| Molecular Weight | 824.07 g/mol |
| Exact Mass | 823.33 |
| IUPAC Name | 2-(9,9-dimethylfluorene-2-carboximidoyl)-1-benzofuran-3-amine;2-(8-methyldibenzothiophen-1-yl)-4,6-diphenyl-1,3,5-triazine;prop-1-ene |
| SMILES | C=CC.Cc1ccc2sc3cccc(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)c3c2c1.[H]/N=C(\c1ccc2c(c1)C(C)(C)c1ccccc1-2)c1oc2ccccc2c1N |
| InChI | InChI=1S/C28H19N3S.C24H20N2O.C3H6/c1-18-15-16-23-22(17-18)25-21(13-8-14-24(25)32-23)28-30-26(19-9-4-2-5-10-19)29-27(31-28)20-11-6-3-7-12-20;1-24(2)18-9-5-3-7-15(18)16-12-11-14(13-19(16)24)21(25)23-22(26)17-8-4-6-10-20(17)27-23;1-3-2/h2-17H,1H3;3-13,25H,26H2,1-2H3;3H,1H2,2H3/b;25-21+; |
| InChIKey | VMYNKHZBRLIDNH-TZPQEBTHSA-N |
| XLogP | 14.48 |
| TPSA | 101.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 824.07 |
| LogP ≤ 5 | 14.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|