C19H21N5 — CID 142915800
(Z)-4-N'-(benzenecarboximidoyl)-1-N'-[(4-methylphenyl)methyl]but-2-enediimidamide (PubChem CID 142915800) has the molecular formula C19H21N5 and a molecular weight of 319.41 g/mol. Its IUPAC name is (Z)-4-N'-(benzenecarboximidoyl)-1-N'-[(4-methylphenyl)methyl]but-2-enediimidamide.
| Compound Name | (Z)-4-N'-(benzenecarboximidoyl)-1-N'-[(4-methylphenyl)methyl]but-2-enediimidamide |
|---|---|
| PubChem CID | 142915800 |
| Molecular Formula | C19H21N5 |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.18 |
| IUPAC Name | (Z)-4-N'-(benzenecarboximidoyl)-1-N'-[(4-methylphenyl)methyl]but-2-enediimidamide |
| SMILES | [H]/N=C(/N=C(N)/C=C\C(N)=N\Cc1ccc(C)cc1)c1ccccc1 |
| InChI | InChI=1S/C19H21N5/c1-14-7-9-15(10-8-14)13-23-17(20)11-12-18(21)24-19(22)16-5-3-2-4-6-16/h2-12H,13H2,1H3,(H2,20,23)(H3,21,22,24)/b12-11- |
| InChIKey | ZGTBWSCXEUYFAV-QXMHVHEDSA-N |
| XLogP | 2.79 |
| TPSA | 100.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|