C18H15F3N4S — CID 126658454
[3-(trifluoromethyl)phenyl] (Z)-4-amino-4-(benzenecarboximidoylimino)but-2-enimidothioate (PubChem CID 126658454) has the molecular formula C18H15F3N4S and a molecular weight of 376.41 g/mol. Its IUPAC name is [3-(trifluoromethyl)phenyl] (Z)-4-amino-4-(benzenecarboximidoylimino)but-2-enimidothioate.
| Compound Name | [3-(trifluoromethyl)phenyl] (Z)-4-amino-4-(benzenecarboximidoylimino)but-2-enimidothioate |
|---|---|
| PubChem CID | 126658454 |
| Molecular Formula | C18H15F3N4S |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.10 |
| IUPAC Name | [3-(trifluoromethyl)phenyl] (Z)-4-amino-4-(benzenecarboximidoylimino)but-2-enimidothioate |
| SMILES | [H]/N=C(/C=C\C(N)=N\C(=N\[H])c1ccccc1)Sc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H15F3N4S/c19-18(20,21)13-7-4-8-14(11-13)26-16(23)10-9-15(22)25-17(24)12-5-2-1-3-6-12/h1-11,23H,(H3,22,24,25)/b10-9-,23-16- |
| InChIKey | JJRCESNLFUFTIW-LBXFQIKCSA-N |
| XLogP | 4.71 |
| TPSA | 86.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|