About (E)-N'-[(4-fluorophenyl)methyl]-3-phenylprop-2-enimidamide;hydrochloride
(E)-N'-[(4-fluorophenyl)methyl]-3-phenylprop-2-enimidamide;hydrochloride (PubChem CID 69118649) has the molecular formula C16H16ClFN2
and a molecular weight of 290.77 g/mol. Its IUPAC name is (E)-N'-[(4-fluorophenyl)methyl]-3-phenylprop-2-enimidamide;hydrochloride.
Molecular Properties
| Compound Name | (E)-N'-[(4-fluorophenyl)methyl]-3-phenylprop-2-enimidamide;hydrochloride |
| PubChem CID | 69118649 |
| Molecular Formula | C16H16ClFN2 |
| Molecular Weight | 290.77 g/mol |
| Exact Mass | 290.10 |
| IUPAC Name | (E)-N'-[(4-fluorophenyl)methyl]-3-phenylprop-2-enimidamide;hydrochloride |
| SMILES | Cl.NC(/C=C/c1ccccc1)=N\Cc1ccc(F)cc1 |
| InChI | InChI=1S/C16H15FN2.ClH/c17-15-9-6-14(7-10-15)12-19-16(18)11-8-13-4-2-1-3-5-13;/h1-11H,12H2,(H2,18,19);1H/b11-8+; |
| InChIKey | YKTVIKWPNWUINL-YGCVIUNWSA-N |
| XLogP | 3.82 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.77 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze (E)-N'-[(4-fluorophenyl)methyl]-3-phenylprop-2-enimidamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-N'-[(4-fluorophenyl)methyl]-3-phenylprop-2-enimidamide;hydrochloride?
The IUPAC name of (E)-N'-[(4-fluorophenyl)methyl]-3-phenylprop-2-enimidamide;hydrochloride (CID 69118649) is (E)-N'-[(4-fluorophenyl)methyl]-3-phenylprop-2-enimidamide;hydrochloride.
What is the SMILES notation for (E)-N'-[(4-fluorophenyl)methyl]-3-phenylprop-2-enimidamide;hydrochloride?
The canonical SMILES for (E)-N'-[(4-fluorophenyl)methyl]-3-phenylprop-2-enimidamide;hydrochloride is Cl.NC(/C=C/c1ccccc1)=N\Cc1ccc(F)cc1.
What is the InChIKey of (E)-N'-[(4-fluorophenyl)methyl]-3-phenylprop-2-enimidamide;hydrochloride?
The InChIKey is YKTVIKWPNWUINL-YGCVIUNWSA-N. The full InChI is InChI=1S/C16H15FN2.ClH/c17-15-9-6-14(7-10-15)12-19-16(18)11-8-13-4-2-1-3-5-13;/h1-11H,12H2,(H2,18,19);1H/b11-8+;.
What are the key properties of (E)-N'-[(4-fluorophenyl)methyl]-3-phenylprop-2-enimidamide;hydrochloride?
(E)-N'-[(4-fluorophenyl)methyl]-3-phenylprop-2-enimidamide;hydrochloride has a molecular weight of 290.77 g/mol, XLogP of 3.82, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-N'-[(4-fluorophenyl)methyl]-3-phenylprop-2-enimidamide;hydrochloride is sourced from PubChem (CID 69118649), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).