C17H16N2 — CID 154293202
1,5-diphenylpenta-1,4-dien-3-ylidenehydrazine (PubChem CID 154293202) has the molecular formula C17H16N2 and a molecular weight of 248.33 g/mol. Its IUPAC name is 1,5-diphenylpenta-1,4-dien-3-ylidenehydrazine.
| Compound Name | 1,5-diphenylpenta-1,4-dien-3-ylidenehydrazine |
|---|---|
| PubChem CID | 154293202 |
| Molecular Formula | C17H16N2 |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | 1,5-diphenylpenta-1,4-dien-3-ylidenehydrazine |
| SMILES | NN=C(C=Cc1ccccc1)C=Cc1ccccc1 |
| InChI | InChI=1S/C17H16N2/c18-19-17(13-11-15-7-3-1-4-8-15)14-12-16-9-5-2-6-10-16/h1-14H,18H2 |
| InChIKey | ZXJDLGSYSZFZOK-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|