C18H14F2 — CID 53441080
(3,4-difluoro-6-phenylhexa-1,3,5-trienyl)benzene (PubChem CID 53441080) has the molecular formula C18H14F2 and a molecular weight of 268.31 g/mol. Its IUPAC name is (3,4-difluoro-6-phenylhexa-1,3,5-trienyl)benzene.
| Compound Name | (3,4-difluoro-6-phenylhexa-1,3,5-trienyl)benzene |
|---|---|
| PubChem CID | 53441080 |
| Molecular Formula | C18H14F2 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | (3,4-difluoro-6-phenylhexa-1,3,5-trienyl)benzene |
| SMILES | FC(C=Cc1ccccc1)=C(F)C=Cc1ccccc1 |
| InChI | InChI=1S/C18H14F2/c19-17(13-11-15-7-3-1-4-8-15)18(20)14-12-16-9-5-2-6-10-16/h1-14H |
| InChIKey | DNSFOKNRMZZHRG-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|