C10H7F3 — CID 54356019
3,4,4-trifluorobuta-1,3-dienylbenzene (PubChem CID 54356019) has the molecular formula C10H7F3 and a molecular weight of 184.16 g/mol. Its IUPAC name is 3,4,4-trifluorobuta-1,3-dienylbenzene.
| Compound Name | 3,4,4-trifluorobuta-1,3-dienylbenzene |
|---|---|
| PubChem CID | 54356019 |
| Molecular Formula | C10H7F3 |
| Molecular Weight | 184.16 g/mol |
| Exact Mass | 184.05 |
| IUPAC Name | 3,4,4-trifluorobuta-1,3-dienylbenzene |
| SMILES | FC(F)=C(F)C=Cc1ccccc1 |
| InChI | InChI=1S/C10H7F3/c11-9(10(12)13)7-6-8-4-2-1-3-5-8/h1-7H |
| InChIKey | UJDQAVASRXCZAS-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.16 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|