C16H14FNO — CID 102344328
(Z,E)-1-(4-fluorophenyl)-N-methoxy-3-phenylprop-2-en-1-imine (PubChem CID 102344328) has the molecular formula C16H14FNO and a molecular weight of 255.29 g/mol. Its IUPAC name is (Z,E)-1-(4-fluorophenyl)-N-methoxy-3-phenylprop-2-en-1-imine.
| Compound Name | (Z,E)-1-(4-fluorophenyl)-N-methoxy-3-phenylprop-2-en-1-imine |
|---|---|
| PubChem CID | 102344328 |
| Molecular Formula | C16H14FNO |
| Molecular Weight | 255.29 g/mol |
| Exact Mass | 255.11 |
| IUPAC Name | (Z,E)-1-(4-fluorophenyl)-N-methoxy-3-phenylprop-2-en-1-imine |
| SMILES | CO/N=C(/C=C/c1ccccc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C16H14FNO/c1-19-18-16(14-8-10-15(17)11-9-14)12-7-13-5-3-2-4-6-13/h2-12H,1H3/b12-7+,18-16- |
| InChIKey | XACGRCSAUYZPFI-FOXGNPIRSA-N |
| XLogP | 3.89 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.29 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|