C24H23N — CID 102368885
(E)-N-(2,6-dimethylphenyl)-1-(4-methylphenyl)-3-phenylprop-2-en-1-imine (PubChem CID 102368885) has the molecular formula C24H23N and a molecular weight of 325.45 g/mol. Its IUPAC name is (E)-N-(2,6-dimethylphenyl)-1-(4-methylphenyl)-3-phenylprop-2-en-1-imine.
| Compound Name | (E)-N-(2,6-dimethylphenyl)-1-(4-methylphenyl)-3-phenylprop-2-en-1-imine |
|---|---|
| PubChem CID | 102368885 |
| Molecular Formula | C24H23N |
| Molecular Weight | 325.45 g/mol |
| Exact Mass | 325.18 |
| IUPAC Name | (E)-N-(2,6-dimethylphenyl)-1-(4-methylphenyl)-3-phenylprop-2-en-1-imine |
| SMILES | Cc1ccc(C(/C=C/c2ccccc2)=N/c2c(C)cccc2C)cc1 |
| InChI | InChI=1S/C24H23N/c1-18-12-15-22(16-13-18)23(17-14-21-10-5-4-6-11-21)25-24-19(2)8-7-9-20(24)3/h4-17H,1-3H3/b17-14+,25-23+ |
| InChIKey | JMRDRQXZMYYZQL-UGPUUWOHSA-N |
| XLogP | 6.45 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.45 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|