C40H34 — CID 11730962
1,4-bis[(1E,3E)-1-(4-methylphenyl)-4-phenylbuta-1,3-dienyl]benzene (PubChem CID 11730962) has the molecular formula C40H34 and a molecular weight of 514.71 g/mol. Its IUPAC name is 1,4-bis[(1E,3E)-1-(4-methylphenyl)-4-phenylbuta-1,3-dienyl]benzene.
| Compound Name | 1,4-bis[(1E,3E)-1-(4-methylphenyl)-4-phenylbuta-1,3-dienyl]benzene |
|---|---|
| PubChem CID | 11730962 |
| Molecular Formula | C40H34 |
| Molecular Weight | 514.71 g/mol |
| Exact Mass | 514.27 |
| IUPAC Name | 1,4-bis[(1E,3E)-1-(4-methylphenyl)-4-phenylbuta-1,3-dienyl]benzene |
| SMILES | Cc1ccc(/C(=C\C=C\c2ccccc2)c2ccc(/C(=C/C=C/c3ccccc3)c3ccc(C)cc3)cc2)cc1 |
| InChI | InChI=1S/C40H34/c1-31-19-23-35(24-20-31)39(17-9-15-33-11-5-3-6-12-33)37-27-29-38(30-28-37)40(36-25-21-32(2)22-26-36)18-10-16-34-13-7-4-8-14-34/h3-30H,1-2H3/b15-9+,16-10+,39-17+,40-18+ |
| InChIKey | BPYRQWXTSKKLEN-URUNXJQISA-N |
| XLogP | 10.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.71 |
| LogP ≤ 5 | 10.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|