C44H35Br2N — CID 23517941
N-[2,2-bis(4-bromophenyl)ethenyl]-4-[(1E)-4,4-bis(4-methylphenyl)buta-1,3-dienyl]-N-phenylaniline (PubChem CID 23517941) has the molecular formula C44H35Br2N and a molecular weight of 737.58 g/mol. Its IUPAC name is N-[2,2-bis(4-bromophenyl)ethenyl]-4-[(1E)-4,4-bis(4-methylphenyl)buta-1,3-dienyl]-N-phenylaniline.
| Compound Name | N-[2,2-bis(4-bromophenyl)ethenyl]-4-[(1E)-4,4-bis(4-methylphenyl)buta-1,3-dienyl]-N-phenylaniline |
|---|---|
| PubChem CID | 23517941 |
| Molecular Formula | C44H35Br2N |
| Molecular Weight | 737.58 g/mol |
| Exact Mass | 735.11 |
| IUPAC Name | N-[2,2-bis(4-bromophenyl)ethenyl]-4-[(1E)-4,4-bis(4-methylphenyl)buta-1,3-dienyl]-N-phenylaniline |
| SMILES | Cc1ccc(C(=C/C=C/c2ccc(N(C=C(c3ccc(Br)cc3)c3ccc(Br)cc3)c3ccccc3)cc2)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C44H35Br2N/c1-32-11-17-35(18-12-32)43(36-19-13-33(2)14-20-36)10-6-7-34-15-29-42(30-16-34)47(41-8-4-3-5-9-41)31-44(37-21-25-39(45)26-22-37)38-23-27-40(46)28-24-38/h3-31H,1-2H3/b7-6+ |
| InChIKey | UBZCALDBFPPBST-VOTSOKGWSA-N |
| XLogP | 13.20 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 737.58 |
| LogP ≤ 5 | 13.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|