C45H39NO — CID 23517965
N-[2,2-bis(4-methylphenyl)ethenyl]-4-[(1E)-4,4-diphenylbuta-1,3-dienyl]-N-(4-methoxyphenyl)aniline (PubChem CID 23517965) has the molecular formula C45H39NO and a molecular weight of 609.81 g/mol. Its IUPAC name is N-[2,2-bis(4-methylphenyl)ethenyl]-4-[(1E)-4,4-diphenylbuta-1,3-dienyl]-N-(4-methoxyphenyl)aniline.
| Compound Name | N-[2,2-bis(4-methylphenyl)ethenyl]-4-[(1E)-4,4-diphenylbuta-1,3-dienyl]-N-(4-methoxyphenyl)aniline |
|---|---|
| PubChem CID | 23517965 |
| Molecular Formula | C45H39NO |
| Molecular Weight | 609.81 g/mol |
| Exact Mass | 609.30 |
| IUPAC Name | N-[2,2-bis(4-methylphenyl)ethenyl]-4-[(1E)-4,4-diphenylbuta-1,3-dienyl]-N-(4-methoxyphenyl)aniline |
| SMILES | COc1ccc(N(C=C(c2ccc(C)cc2)c2ccc(C)cc2)c2ccc(/C=C/C=C(c3ccccc3)c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C45H39NO/c1-34-17-23-39(24-18-34)45(40-25-19-35(2)20-26-40)33-46(42-29-31-43(47-3)32-30-42)41-27-21-36(22-28-41)11-10-16-44(37-12-6-4-7-13-37)38-14-8-5-9-15-38/h4-33H,1-3H3/b11-10+ |
| InChIKey | WOUTYIMJPKSUHW-ZHACJKMWSA-N |
| XLogP | 11.68 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.81 |
| LogP ≤ 5 | 11.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|