C43H33Cl2NO — CID 23517949
N-[2,2-bis(4-chlorophenyl)ethenyl]-4-[(1E)-4,4-diphenylbuta-1,3-dienyl]-N-(4-methoxyphenyl)aniline (PubChem CID 23517949) has the molecular formula C43H33Cl2NO and a molecular weight of 650.65 g/mol. Its IUPAC name is N-[2,2-bis(4-chlorophenyl)ethenyl]-4-[(1E)-4,4-diphenylbuta-1,3-dienyl]-N-(4-methoxyphenyl)aniline.
| Compound Name | N-[2,2-bis(4-chlorophenyl)ethenyl]-4-[(1E)-4,4-diphenylbuta-1,3-dienyl]-N-(4-methoxyphenyl)aniline |
|---|---|
| PubChem CID | 23517949 |
| Molecular Formula | C43H33Cl2NO |
| Molecular Weight | 650.65 g/mol |
| Exact Mass | 649.19 |
| IUPAC Name | N-[2,2-bis(4-chlorophenyl)ethenyl]-4-[(1E)-4,4-diphenylbuta-1,3-dienyl]-N-(4-methoxyphenyl)aniline |
| SMILES | COc1ccc(N(C=C(c2ccc(Cl)cc2)c2ccc(Cl)cc2)c2ccc(/C=C/C=C(c3ccccc3)c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C43H33Cl2NO/c1-47-41-29-27-40(28-30-41)46(31-43(35-17-21-37(44)22-18-35)36-19-23-38(45)24-20-36)39-25-15-32(16-26-39)9-8-14-42(33-10-4-2-5-11-33)34-12-6-3-7-13-34/h2-31H,1H3/b9-8+ |
| InChIKey | DEYDUWWNOTYKBK-CMDGGOBGSA-N |
| XLogP | 12.37 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.65 |
| LogP ≤ 5 | 12.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|