C43H33F2N — CID 23517958
N-[2,2-bis(4-fluorophenyl)ethenyl]-N-[4-[(1E)-4,4-diphenylbuta-1,3-dienyl]phenyl]-4-methylaniline (PubChem CID 23517958) has the molecular formula C43H33F2N and a molecular weight of 601.74 g/mol. Its IUPAC name is N-[2,2-bis(4-fluorophenyl)ethenyl]-N-[4-[(1E)-4,4-diphenylbuta-1,3-dienyl]phenyl]-4-methylaniline.
| Compound Name | N-[2,2-bis(4-fluorophenyl)ethenyl]-N-[4-[(1E)-4,4-diphenylbuta-1,3-dienyl]phenyl]-4-methylaniline |
|---|---|
| PubChem CID | 23517958 |
| Molecular Formula | C43H33F2N |
| Molecular Weight | 601.74 g/mol |
| Exact Mass | 601.26 |
| IUPAC Name | N-[2,2-bis(4-fluorophenyl)ethenyl]-N-[4-[(1E)-4,4-diphenylbuta-1,3-dienyl]phenyl]-4-methylaniline |
| SMILES | Cc1ccc(N(C=C(c2ccc(F)cc2)c2ccc(F)cc2)c2ccc(/C=C/C=C(c3ccccc3)c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C43H33F2N/c1-32-15-27-40(28-16-32)46(31-43(36-19-23-38(44)24-20-36)37-21-25-39(45)26-22-37)41-29-17-33(18-30-41)9-8-14-42(34-10-4-2-5-11-34)35-12-6-3-7-13-35/h2-31H,1H3/b9-8+ |
| InChIKey | MEPSTACSRCHDBP-CMDGGOBGSA-N |
| XLogP | 11.65 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.74 |
| LogP ≤ 5 | 11.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|