C62H47N — CID 87948616
4-[4-[(1E)-4,4-diphenylbuta-1,3-dienyl]phenyl]-N-[4-[4-[(1E)-4,4-diphenylbuta-1,3-dienyl]phenyl]phenyl]-N-phenylaniline (PubChem CID 87948616) has the molecular formula C62H47N and a molecular weight of 806.07 g/mol. Its IUPAC name is 4-[4-[(1E)-4,4-diphenylbuta-1,3-dienyl]phenyl]-N-[4-[4-[(1E)-4,4-diphenylbuta-1,3-dienyl]phenyl]phenyl]-N-phenylaniline.
| Compound Name | 4-[4-[(1E)-4,4-diphenylbuta-1,3-dienyl]phenyl]-N-[4-[4-[(1E)-4,4-diphenylbuta-1,3-dienyl]phenyl]phenyl]-N-phenylaniline |
|---|---|
| PubChem CID | 87948616 |
| Molecular Formula | C62H47N |
| Molecular Weight | 806.07 g/mol |
| Exact Mass | 805.37 |
| IUPAC Name | 4-[4-[(1E)-4,4-diphenylbuta-1,3-dienyl]phenyl]-N-[4-[4-[(1E)-4,4-diphenylbuta-1,3-dienyl]phenyl]phenyl]-N-phenylaniline |
| SMILES | C(/C=C/c1ccc(-c2ccc(N(c3ccccc3)c3ccc(-c4ccc(/C=C/C=C(c5ccccc5)c5ccccc5)cc4)cc3)cc2)cc1)=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C62H47N/c1-6-20-54(21-7-1)61(55-22-8-2-9-23-55)30-16-18-48-32-36-50(37-33-48)52-40-44-59(45-41-52)63(58-28-14-5-15-29-58)60-46-42-53(43-47-60)51-38-34-49(35-39-51)19-17-31-62(56-24-10-3-11-25-56)57-26-12-4-13-27-57/h1-47H/b18-16+,19-17+ |
| InChIKey | GMQMPWOSAANIPI-YWNVXTCZSA-N |
| XLogP | 16.78 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 806.07 |
| LogP ≤ 5 | 16.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|