C84H63N — CID 87948560
4-[4-[(1E)-4,4-diphenylbuta-1,3-dienyl]phenyl]-N,N-bis[4-[4-[(1E)-4,4-diphenylbuta-1,3-dienyl]phenyl]phenyl]aniline (PubChem CID 87948560) has the molecular formula C84H63N and a molecular weight of 1086.44 g/mol. Its IUPAC name is 4-[4-[(1E)-4,4-diphenylbuta-1,3-dienyl]phenyl]-N,N-bis[4-[4-[(1E)-4,4-diphenylbuta-1,3-dienyl]phenyl]phenyl]aniline.
| Compound Name | 4-[4-[(1E)-4,4-diphenylbuta-1,3-dienyl]phenyl]-N,N-bis[4-[4-[(1E)-4,4-diphenylbuta-1,3-dienyl]phenyl]phenyl]aniline |
|---|---|
| PubChem CID | 87948560 |
| Molecular Formula | C84H63N |
| Molecular Weight | 1086.44 g/mol |
| Exact Mass | 1085.50 |
| IUPAC Name | 4-[4-[(1E)-4,4-diphenylbuta-1,3-dienyl]phenyl]-N,N-bis[4-[4-[(1E)-4,4-diphenylbuta-1,3-dienyl]phenyl]phenyl]aniline |
| SMILES | C(/C=C/c1ccc(-c2ccc(N(c3ccc(-c4ccc(/C=C/C=C(c5ccccc5)c5ccccc5)cc4)cc3)c3ccc(-c4ccc(/C=C/C=C(c5ccccc5)c5ccccc5)cc4)cc3)cc2)cc1)=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C84H63N/c1-7-25-73(26-8-1)82(74-27-9-2-10-28-74)37-19-22-64-40-46-67(47-41-64)70-52-58-79(59-53-70)85(80-60-54-71(55-61-80)68-48-42-65(43-49-68)23-20-38-83(75-29-11-3-12-30-75)76-31-13-4-14-32-76)81-62-56-72(57-63-81)69-50-44-66(45-51-69)24-21-39-84(77-33-15-5-16-34-77)78-35-17-6-18-36-78/h1-63H/b22-19+,23-20+,24-21+ |
| InChIKey | SQMFLCILXCMHAO-IKVQWSBMSA-N |
| XLogP | 22.59 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 85 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1086.44 |
| LogP ≤ 5 | 22.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|