C47H43NO — CID 59086916
4-[4,4-bis(4-methylphenyl)buta-1,3-dienyl]-N-[2,2-bis(4-methylphenyl)ethenyl]-N-(4-methoxyphenyl)aniline (PubChem CID 59086916) has the molecular formula C47H43NO and a molecular weight of 637.87 g/mol. Its IUPAC name is 4-[4,4-bis(4-methylphenyl)buta-1,3-dienyl]-N-[2,2-bis(4-methylphenyl)ethenyl]-N-(4-methoxyphenyl)aniline.
| Compound Name | 4-[4,4-bis(4-methylphenyl)buta-1,3-dienyl]-N-[2,2-bis(4-methylphenyl)ethenyl]-N-(4-methoxyphenyl)aniline |
|---|---|
| PubChem CID | 59086916 |
| Molecular Formula | C47H43NO |
| Molecular Weight | 637.87 g/mol |
| Exact Mass | 637.33 |
| IUPAC Name | 4-[4,4-bis(4-methylphenyl)buta-1,3-dienyl]-N-[2,2-bis(4-methylphenyl)ethenyl]-N-(4-methoxyphenyl)aniline |
| SMILES | COc1ccc(N(C=C(c2ccc(C)cc2)c2ccc(C)cc2)c2ccc(C=CC=C(c3ccc(C)cc3)c3ccc(C)cc3)cc2)cc1 |
| InChI | InChI=1S/C47H43NO/c1-34-9-19-39(20-10-34)46(40-21-11-35(2)12-22-40)8-6-7-38-17-27-43(28-18-38)48(44-29-31-45(49-5)32-30-44)33-47(41-23-13-36(3)14-24-41)42-25-15-37(4)16-26-42/h6-33H,1-5H3 |
| InChIKey | ISVBGXNPIGDIGK-UHFFFAOYSA-N |
| XLogP | 12.30 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.87 |
| LogP ≤ 5 | 12.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|