C38H35NO2 — CID 87385829
4-[(1E)-4,4-bis(4-methylphenyl)buta-1,3-dienyl]-N,N-bis(4-methoxyphenyl)aniline (PubChem CID 87385829) has the molecular formula C38H35NO2 and a molecular weight of 537.70 g/mol. Its IUPAC name is 4-[(1E)-4,4-bis(4-methylphenyl)buta-1,3-dienyl]-N,N-bis(4-methoxyphenyl)aniline.
| Compound Name | 4-[(1E)-4,4-bis(4-methylphenyl)buta-1,3-dienyl]-N,N-bis(4-methoxyphenyl)aniline |
|---|---|
| PubChem CID | 87385829 |
| Molecular Formula | C38H35NO2 |
| Molecular Weight | 537.70 g/mol |
| Exact Mass | 537.27 |
| IUPAC Name | 4-[(1E)-4,4-bis(4-methylphenyl)buta-1,3-dienyl]-N,N-bis(4-methoxyphenyl)aniline |
| SMILES | COc1ccc(N(c2ccc(/C=C/C=C(c3ccc(C)cc3)c3ccc(C)cc3)cc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C38H35NO2/c1-28-8-14-31(15-9-28)38(32-16-10-29(2)11-17-32)7-5-6-30-12-18-33(19-13-30)39(34-20-24-36(40-3)25-21-34)35-22-26-37(41-4)27-23-35/h5-27H,1-4H3/b6-5+ |
| InChIKey | SPZSPPLZIQCQLY-AATRIKPKSA-N |
| XLogP | 9.94 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.70 |
| LogP ≤ 5 | 9.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|