C19H17NO — CID 6341462
(2E,4E)-5-(4-methoxyphenyl)-2-(4-methylphenyl)penta-2,4-dienenitrile (PubChem CID 6341462) has the molecular formula C19H17NO and a molecular weight of 275.35 g/mol. Its IUPAC name is (2E,4E)-5-(4-methoxyphenyl)-2-(4-methylphenyl)penta-2,4-dienenitrile.
| Compound Name | (2E,4E)-5-(4-methoxyphenyl)-2-(4-methylphenyl)penta-2,4-dienenitrile |
|---|---|
| PubChem CID | 6341462 |
| Molecular Formula | C19H17NO |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | (2E,4E)-5-(4-methoxyphenyl)-2-(4-methylphenyl)penta-2,4-dienenitrile |
| SMILES | COc1ccc(/C=C/C=C(/C#N)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C19H17NO/c1-15-6-10-17(11-7-15)18(14-20)5-3-4-16-8-12-19(21-2)13-9-16/h3-13H,1-2H3/b4-3+,18-5- |
| InChIKey | BIQAUNGJIPUFGD-ONCSWLTESA-N |
| XLogP | 4.62 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|