C13H12N2OS — CID 74258795
2-cyano-5-(4-methoxyphenyl)penta-2,4-dienethioamide (PubChem CID 74258795) has the molecular formula C13H12N2OS and a molecular weight of 244.32 g/mol. Its IUPAC name is 2-cyano-5-(4-methoxyphenyl)penta-2,4-dienethioamide.
| Compound Name | 2-cyano-5-(4-methoxyphenyl)penta-2,4-dienethioamide |
|---|---|
| PubChem CID | 74258795 |
| Molecular Formula | C13H12N2OS |
| Molecular Weight | 244.32 g/mol |
| Exact Mass | 244.07 |
| IUPAC Name | 2-cyano-5-(4-methoxyphenyl)penta-2,4-dienethioamide |
| SMILES | COc1ccc(C=CC=C(C#N)C(N)=S)cc1 |
| InChI | InChI=1S/C13H12N2OS/c1-16-12-7-5-10(6-8-12)3-2-4-11(9-14)13(15)17/h2-8H,1H3,(H2,15,17) |
| InChIKey | KIRCJLMBMDDROL-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 59.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.32 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|