C11H13N3OS — CID 93084415
[(Z)-[(Z)-3-(4-methoxyphenyl)prop-2-enylidene]amino]thiourea (PubChem CID 93084415) has the molecular formula C11H13N3OS and a molecular weight of 235.31 g/mol. Its IUPAC name is [(Z)-[(Z)-3-(4-methoxyphenyl)prop-2-enylidene]amino]thiourea.
| Compound Name | [(Z)-[(Z)-3-(4-methoxyphenyl)prop-2-enylidene]amino]thiourea |
|---|---|
| PubChem CID | 93084415 |
| Molecular Formula | C11H13N3OS |
| Molecular Weight | 235.31 g/mol |
| Exact Mass | 235.08 |
| IUPAC Name | [(Z)-[(Z)-3-(4-methoxyphenyl)prop-2-enylidene]amino]thiourea |
| SMILES | COc1ccc(/C=C\C=N/NC(N)=S)cc1 |
| InChI | InChI=1S/C11H13N3OS/c1-15-10-6-4-9(5-7-10)3-2-8-13-14-11(12)16/h2-8H,1H3,(H3,12,14,16)/b3-2-,13-8- |
| InChIKey | ORFNREOSBWPYJL-YSWQPJJHSA-N |
| XLogP | 1.53 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.31 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|