C9H12N4OS — CID 2728543
1-amino-3-[(4-methoxyphenyl)methylideneamino]thiourea (PubChem CID 2728543) has the molecular formula C9H12N4OS and a molecular weight of 224.29 g/mol. Its IUPAC name is 1-amino-3-[(4-methoxyphenyl)methylideneamino]thiourea.
| Compound Name | 1-amino-3-[(4-methoxyphenyl)methylideneamino]thiourea |
|---|---|
| PubChem CID | 2728543 |
| Molecular Formula | C9H12N4OS |
| Molecular Weight | 224.29 g/mol |
| Exact Mass | 224.07 |
| IUPAC Name | 1-amino-3-[(4-methoxyphenyl)methylideneamino]thiourea |
| SMILES | COc1ccc(C=NNC(=S)NN)cc1 |
| InChI | InChI=1S/C9H12N4OS/c1-14-8-4-2-7(3-5-8)6-11-13-9(15)12-10/h2-6H,10H2,1H3,(H2,12,13,15) |
| InChIKey | ALUNYGIHKGJPPK-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 71.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.29 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|