C13H19N3O2S — CID 2803675
1-[(4-methoxyphenyl)methylideneamino]-3-(3-methoxypropyl)thiourea (PubChem CID 2803675) has the molecular formula C13H19N3O2S and a molecular weight of 281.38 g/mol. Its IUPAC name is 1-[(4-methoxyphenyl)methylideneamino]-3-(3-methoxypropyl)thiourea.
| Compound Name | 1-[(4-methoxyphenyl)methylideneamino]-3-(3-methoxypropyl)thiourea |
|---|---|
| PubChem CID | 2803675 |
| Molecular Formula | C13H19N3O2S |
| Molecular Weight | 281.38 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | 1-[(4-methoxyphenyl)methylideneamino]-3-(3-methoxypropyl)thiourea |
| SMILES | COCCCNC(=S)NN=Cc1ccc(OC)cc1 |
| InChI | InChI=1S/C13H19N3O2S/c1-17-9-3-8-14-13(19)16-15-10-11-4-6-12(18-2)7-5-11/h4-7,10H,3,8-9H2,1-2H3,(H2,14,16,19) |
| InChIKey | PMGBMWVJVLRWNK-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.38 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|