C14H19N3O3 — CID 46741726
N-(3-methoxypropyl)-N'-[(E)-(4-methylphenyl)methylideneamino]oxamide (PubChem CID 46741726) has the molecular formula C14H19N3O3 and a molecular weight of 277.32 g/mol. Its IUPAC name is N-(3-methoxypropyl)-N'-[(E)-(4-methylphenyl)methylideneamino]oxamide.
| Compound Name | N-(3-methoxypropyl)-N'-[(E)-(4-methylphenyl)methylideneamino]oxamide |
|---|---|
| PubChem CID | 46741726 |
| Molecular Formula | C14H19N3O3 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.14 |
| IUPAC Name | N-(3-methoxypropyl)-N'-[(E)-(4-methylphenyl)methylideneamino]oxamide |
| SMILES | COCCCNC(=O)C(=O)N/N=C/c1ccc(C)cc1 |
| InChI | InChI=1S/C14H19N3O3/c1-11-4-6-12(7-5-11)10-16-17-14(19)13(18)15-8-3-9-20-2/h4-7,10H,3,8-9H2,1-2H3,(H,15,18)(H,17,19)/b16-10+ |
| InChIKey | BLUZKWLVUZQQFU-MHWRWJLKSA-N |
| XLogP | 0.60 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|