C21H22N3O6- — CID 8989446
4-[[4-[(Z)-[[2-(3-methoxypropylamino)-2-oxoacetyl]hydrazinylidene]methyl]phenoxy]methyl]benzoate (PubChem CID 8989446) has the molecular formula C21H22N3O6- and a molecular weight of 412.42 g/mol. Its IUPAC name is 4-[[4-[(Z)-[[2-(3-methoxypropylamino)-2-oxoacetyl]hydrazinylidene]methyl]phenoxy]methyl]benzoate.
| Compound Name | 4-[[4-[(Z)-[[2-(3-methoxypropylamino)-2-oxoacetyl]hydrazinylidene]methyl]phenoxy]methyl]benzoate |
|---|---|
| PubChem CID | 8989446 |
| Molecular Formula | C21H22N3O6- |
| Molecular Weight | 412.42 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | 4-[[4-[(Z)-[[2-(3-methoxypropylamino)-2-oxoacetyl]hydrazinylidene]methyl]phenoxy]methyl]benzoate |
| SMILES | COCCCNC(=O)C(=O)N/N=C\c1ccc(OCc2ccc(C(=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C21H23N3O6/c1-29-12-2-11-22-19(25)20(26)24-23-13-15-5-9-18(10-6-15)30-14-16-3-7-17(8-4-16)21(27)28/h3-10,13H,2,11-12,14H2,1H3,(H,22,25)(H,24,26)(H,27,28)/p-1/b23-13- |
| InChIKey | LEPYWIHUMFQFEO-QRVIBDJDSA-M |
| XLogP | 0.23 |
| TPSA | 129.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.42 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|