C28H31N — CID 23517911
4-[(1E)-4,4-bis(4-methylphenyl)buta-1,3-dienyl]-N-tert-butylaniline (PubChem CID 23517911) has the molecular formula C28H31N and a molecular weight of 381.56 g/mol. Its IUPAC name is 4-[(1E)-4,4-bis(4-methylphenyl)buta-1,3-dienyl]-N-tert-butylaniline.
| Compound Name | 4-[(1E)-4,4-bis(4-methylphenyl)buta-1,3-dienyl]-N-tert-butylaniline |
|---|---|
| PubChem CID | 23517911 |
| Molecular Formula | C28H31N |
| Molecular Weight | 381.56 g/mol |
| Exact Mass | 381.25 |
| IUPAC Name | 4-[(1E)-4,4-bis(4-methylphenyl)buta-1,3-dienyl]-N-tert-butylaniline |
| SMILES | Cc1ccc(C(=C/C=C/c2ccc(NC(C)(C)C)cc2)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C28H31N/c1-21-9-15-24(16-10-21)27(25-17-11-22(2)12-18-25)8-6-7-23-13-19-26(20-14-23)29-28(3,4)5/h6-20,29H,1-5H3/b7-6+ |
| InChIKey | GLXQNFHMFSWVLV-VOTSOKGWSA-N |
| XLogP | 7.66 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.56 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|