C13H15NO2 — CID 15262562
prop-2-enyl (E,1E)-N-methoxy-3-phenylprop-2-enimidate (PubChem CID 15262562) has the molecular formula C13H15NO2 and a molecular weight of 217.27 g/mol. Its IUPAC name is prop-2-enyl (E,1E)-N-methoxy-3-phenylprop-2-enimidate.
| Compound Name | prop-2-enyl (E,1E)-N-methoxy-3-phenylprop-2-enimidate |
|---|---|
| PubChem CID | 15262562 |
| Molecular Formula | C13H15NO2 |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.11 |
| IUPAC Name | prop-2-enyl (E,1E)-N-methoxy-3-phenylprop-2-enimidate |
| SMILES | C=CCOC(/C=C/c1ccccc1)=N/OC |
| InChI | InChI=1S/C13H15NO2/c1-3-11-16-13(14-15-2)10-9-12-7-5-4-6-8-12/h3-10H,1,11H2,2H3/b10-9+,14-13+ |
| InChIKey | RNJVILBMMPNRST-LBSPPQMYSA-N |
| XLogP | 2.86 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|