C11H12O — CID 24972289
[(1Z)-3-methoxybuta-1,3-dienyl]benzene (PubChem CID 24972289) has the molecular formula C11H12O and a molecular weight of 160.22 g/mol. Its IUPAC name is [(1Z)-3-methoxybuta-1,3-dienyl]benzene.
| Compound Name | [(1Z)-3-methoxybuta-1,3-dienyl]benzene |
|---|---|
| PubChem CID | 24972289 |
| Molecular Formula | C11H12O |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.09 |
| IUPAC Name | [(1Z)-3-methoxybuta-1,3-dienyl]benzene |
| SMILES | C=C(/C=C\c1ccccc1)OC |
| InChI | InChI=1S/C11H12O/c1-10(12-2)8-9-11-6-4-3-5-7-11/h3-9H,1H2,2H3/b9-8- |
| InChIKey | NRRQXLYOHDBBBS-HJWRWDBZSA-N |
| XLogP | 2.86 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|