C17H15FN2O2 — CID 923626
(E)-3-(4-fluorophenyl)-N'-(2-phenylacetyl)prop-2-enehydrazide (PubChem CID 923626) has the molecular formula C17H15FN2O2 and a molecular weight of 298.32 g/mol. Its IUPAC name is (E)-3-(4-fluorophenyl)-N'-(2-phenylacetyl)prop-2-enehydrazide.
| Compound Name | (E)-3-(4-fluorophenyl)-N'-(2-phenylacetyl)prop-2-enehydrazide |
|---|---|
| PubChem CID | 923626 |
| Molecular Formula | C17H15FN2O2 |
| Molecular Weight | 298.32 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | (E)-3-(4-fluorophenyl)-N'-(2-phenylacetyl)prop-2-enehydrazide |
| SMILES | O=C(/C=C/c1ccc(F)cc1)NNC(=O)Cc1ccccc1 |
| InChI | InChI=1S/C17H15FN2O2/c18-15-9-6-13(7-10-15)8-11-16(21)19-20-17(22)12-14-4-2-1-3-5-14/h1-11H,12H2,(H,19,21)(H,20,22)/b11-8+ |
| InChIKey | ZNDHTIZGJSUYPO-DHZHZOJOSA-N |
| XLogP | 2.23 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.32 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|